Name | 2-{2-[(acetyloxy)methyl]oxiran-2-yl}-4-methoxy-5-methylphenyl 3-methylbutanoate |
Wikidata | Q105185857 |
Mol. formula | C18H24O6 |
CAS registry number | - |
Mol. weight | 336.3803 |
Temporary LOTUS id | LTS0276147 |
Name | 2-{2-[(acetyloxy)methyl]oxiran-2-yl}-4-methoxy-5-methylphenyl 3-methylbutanoate |
Canonical SMILES | COc1cc(C2(COC(C)=O)CO2)c(OC(=O)CC(C)C)cc1C |
2D SMILES | COc1cc(C2(COC(C)=O)CO2)c(OC(=O)CC(C)C)cc1C |
IUPAC name | 2-{2-[(acetyloxy)methyl]oxiran-2-yl}-4-methoxy-5-methylphenyl 3-methylbutanoate |
InChI | InChI=1S/C18H24O6/c1-11(2)6-17(20)24-16-7-12(3)15(21-5)8-14(16)18(10-23-18)9-22-13(4)19/h7-8,11H,6,9-10H2,1-5H3 |
InChIKey | NUFZQMTYRQXQPK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC1c2ccccc2 |
Pathway | Superclass | Class |
Polyketides | - | - |
Total atom number | 48 |
Heavy atom number | 24 |
Bond count | 25 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 2.79 |
Alogp2 | 7.78 |
Apol | 52.495 |
Bpol | 35.817 |
EccentricConnectivityIndexDescriptor | 412 |
FmfDescriptor | 0.375 |
Fsp3 | 0.5556 |
FragmentComplexityDescriptor | 1849.06 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1345 |
Xlogp | 2.597 |
ZagrebIndex | 122 |
TopoPSA | 74.36 |