Name | 3-(4-hydroxyphenyl)-8,8-dimethylpyrano[2,3-f]chromen-4-one |
Wikidata | Q105006937 |
Mol. formula | C20H16O4 |
CAS registry number | - |
Mol. weight | 320.3394 |
Temporary LOTUS id | LTS0275697 |
Name | 3-(4-hydroxyphenyl)-8,8-dimethylpyrano[2,3-f]chromen-4-one |
Canonical SMILES | CC1(C)C=Cc2c(ccc3c(=O)c(-c4ccc(O)cc4)coc23)O1 |
2D SMILES | CC1(C)C=Cc2c(ccc3c(=O)c(-c4ccc(O)cc4)coc23)O1 |
IUPAC name | 3-(4-hydroxyphenyl)-8,8-dimethyl-4H,8H-pyrano[2,3-f]chromen-4-one |
InChI | InChI=1S/C20H16O4/c1-20(2)10-9-14-17(24-20)8-7-15-18(22)16(11-23-19(14)15)12-3-5-13(21)6-4-12/h3-11,21H,1-2H3 |
InChIKey | GDSRNXASWYVDMP-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=C(c2ccccc2)Cc3ccc4OCC=Cc4c13 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Isoflavonoids | Isoflavones |
Total atom number | 40 |
Heavy atom number | 24 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 4.06 |
Alogp2 | 16.47 |
Apol | 49.0767 |
Bpol | 22.2813 |
EccentricConnectivityIndexDescriptor | 515 |
FmfDescriptor | 0.8333 |
Fsp3 | 0.15 |
FragmentComplexityDescriptor | 1297.04 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1321 |
Xlogp | 4.984 |
ZagrebIndex | 136 |
TopoPSA | 59.67 |