Name | (4as,8ar,9ar)-3,8a-dimethyl-5-methylidene-4h,4ah,6h,7h,8h,9h,9ah-naphtho[2,3-b]furan-2-one |
Wikidata | Q105197301 |
Mol. formula | C15H20O2 |
CAS registry number | - |
Mol. weight | 232.3187 |
Temporary LOTUS id | LTS0275034 |
Name | (4as,8ar,9ar)-3,8a-dimethyl-5-methylidene-4h,4ah,6h,7h,8h,9h,9ah-naphtho[2,3-b]furan-2-one |
Canonical SMILES | C=C1CCC[C@]2(C)C[C@H]3OC(=O)C(C)=C3C[C@@H]12 |
2D SMILES | C=C1CCCC2(C)CC3OC(=O)C(C)=C3CC12 |
IUPAC name | (4aS,8aR,9aR)-3,8a-dimethyl-5-methylidene-2H,4H,4aH,5H,6H,7H,8H,8aH,9H,9aH-naphtho[2,3-b]furan-2-one |
InChI | InChI=1S/C15H20O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h12-13H,1,4-8H2,2-3H3/t12-,13+,15+/m0/s1 |
InChIKey | OQYBLUDOOFOBPO-GZBFAFLISA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C2CC3CCCCC3CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 37 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.98 |
Alogp | 3.57 |
Alogp2 | 12.77 |
Apol | 41.3399 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 214 |
FmfDescriptor | 0.7647 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1249.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 450 |
Xlogp | 3.355 |
ZagrebIndex | 98 |
TopoPSA | 26.3 |