Name | Cimicifugic acid a |
Wikidata | Q27237154 |
Mol. formula | C21H20O11 |
CAS registry number | - |
Mol. weight | 448.3777 |
Temporary LOTUS id | LTS0274235 |
Name | Cimicifugic acid a |
Canonical SMILES | COc1cc(/C=C/C(=O)O[C@H](C(=O)O)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O)ccc1O |
2D SMILES | COc1cc(C=CC(=O)OC(C(=O)O)C(O)(Cc2ccc(O)c(O)c2)C(=O)O)ccc1O |
IUPAC name | (2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
InChI | InChI=1S/C21H20O11/c1-31-16-9-11(2-6-14(16)23)4-7-17(25)32-18(19(26)27)21(30,20(28)29)10-12-3-5-13(22)15(24)8-12/h2-9,18,22-24,30H,10H2,1H3,(H,26,27)(H,28,29)/b7-4+/t18-,21-/m1/s1 |
InChIKey | LIJMMUDJSMCVDJ-ZHBFVYIWSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1.c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 52 |
Heavy atom number | 32 |
Bond count | 33 |
Number of carbons | 21 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 1.95 |
Alogp2 | 3.81 |
Apol | 59.1179 |
Bpol | 28.5701 |
EccentricConnectivityIndexDescriptor | 803 |
FmfDescriptor | 0.5938 |
Fsp3 | 0.1905 |
FragmentComplexityDescriptor | 1817.11 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3158 |
Xlogp | 0.904 |
ZagrebIndex | 160 |
TopoPSA | 191.05 |