Name | Methyl (1r,15s,16s,18r,21r)-15-methoxy-2,12-diazahexacyclo[14.2.2.1⁹,¹².0¹,⁹.0³,⁸.0¹⁶,²¹]henicosa-3,5,7-triene-18-carboxylate |
Wikidata | Q105277681 |
Mol. formula | C22H28N2O3 |
CAS registry number | - |
Mol. weight | 368.4702 |
Temporary LOTUS id | LTS0273554 |
Name | Methyl (1r,15s,16s,18r,21r)-15-methoxy-2,12-diazahexacyclo[14.2.2.1⁹,¹².0¹,⁹.0³,⁸.0¹⁶,²¹]henicosa-3,5,7-triene-18-carboxylate |
Canonical SMILES | COC(=O)[C@@H]1C[C@]23CC[C@@]14Nc1ccccc1C41CCN(CC[C@@H]2OC)[C@H]13 |
2D SMILES | COC(=O)C1CC23CCC14Nc1ccccc1C41CCN(CCC2OC)C31 |
IUPAC name | methyl (1R,15S,16S,18R,21R)-15-methoxy-2,12-diazahexacyclo[14.2.2.1⁹,¹².0¹,⁹.0³,⁸.0¹⁶,²¹]henicosa-3,5,7-triene-18-carboxylate |
InChI | InChI=1S/C22H28N2O3/c1-26-17-7-11-24-12-10-21-14-5-3-4-6-16(14)23-22(21)9-8-20(17,19(21)24)13-15(22)18(25)27-2/h3-6,15,17,19,23H,7-13H2,1-2H3/t15-,17-,19-,20+,21?,22+/m0/s1 |
InChIKey | URDXZVLEWZYTSQ-BCURGLILSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)NC34CCC5(CCCN6CCC23C65)CC4 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Aspidosperma type |
Total atom number | 55 |
Heavy atom number | 27 |
Bond count | 32 |
Number of carbons | 22 |
Minimal number of rings | 6 |
Maximal number of rings | 31 |
NP-likeness score | 1.01 |
Alogp | 1.72 |
Alogp2 | 2.97 |
Apol | 61.9962 |
Bpol | 38.0398 |
EccentricConnectivityIndexDescriptor | 424 |
FmfDescriptor | 0.7778 |
Fsp3 | 0.6818 |
FragmentComplexityDescriptor | 2898.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1384 |
Xlogp | 2.244 |
ZagrebIndex | 170 |
TopoPSA | 50.8 |