Name | 7-methoxy-2h,4h,5h,10h,11h-indolo[7a,1-a]isoquinoline-8,11-diol |
Wikidata | Q105025214 |
Mol. formula | C17H19NO3 |
CAS registry number | - |
Mol. weight | 285.3383 |
Temporary LOTUS id | LTS0273536 |
Name | 7-methoxy-2h,4h,5h,10h,11h-indolo[7a,1-a]isoquinoline-8,11-diol |
Canonical SMILES | COc1cc2c(cc1O)C13CC(O)C=CC1=CCN3CC2 |
2D SMILES | COc1cc2c(cc1O)C13CC(O)C=CC1=CCN3CC2 |
IUPAC name | 7-methoxy-2H,4H,5H,10H,11H-indolo[7a,1-a]isoquinoline-8,11-diol |
InChI | InChI=1S/C17H19NO3/c1-21-16-8-11-4-6-18-7-5-12-2-3-13(19)10-17(12,18)14(11)9-15(16)20/h2-3,5,8-9,13,19-20H,4,6-7,10H2,1H3 |
InChIKey | HBCNXWUNPXIERK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)CCN3CC=C4C=CCCC423 |
Pathway | Superclass | Class |
Alkaloids | Lysine alkaloids | Indolizidine alkaloids |
Total atom number | 40 |
Heavy atom number | 21 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1 |
Alogp | 1.6 |
Alogp2 | 2.56 |
Apol | 46.0951 |
Bpol | 24.6669 |
EccentricConnectivityIndexDescriptor | 326 |
FmfDescriptor | 0.8095 |
Fsp3 | 0.4118 |
FragmentComplexityDescriptor | 1429.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 789 |
Xlogp | 0.873 |
ZagrebIndex | 122 |
TopoPSA | 52.93 |