Name | 1,1,3a,7-tetramethyl-1ah,2h,3h,4h,5h,6h,7bh-cyclopropa[a]naphthalene |
Wikidata | Q105276784 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0273480 |
Name | 1,1,3a,7-tetramethyl-1ah,2h,3h,4h,5h,6h,7bh-cyclopropa[a]naphthalene |
Canonical SMILES | CC1=C2C3C(CCC2(C)CCC1)C3(C)C |
2D SMILES | CC1=C2C3C(CCC2(C)CCC1)C3(C)C |
IUPAC name | 1,1,3a,7-tetramethyl-1H,1aH,2H,3H,3aH,4H,5H,6H,7bH-cyclopropa[a]naphthalene |
InChI | InChI=1S/C15H24/c1-10-6-5-8-15(4)9-7-11-13(12(10)15)14(11,2)3/h11,13H,5-9H2,1-4H3 |
InChIKey | UPGLJTCDRBIZKP-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2C(CCC1)CCC3CC23 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Cycloeudesmane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 4.32 |
Alogp2 | 18.65 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 156 |
FmfDescriptor | 0.7333 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1471 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 307 |
Xlogp | 5.848 |
ZagrebIndex | 92 |
TopoPSA | 0 |