Name | (2s,4z,7s,8s)-2-[(1r)-1-bromopropyl]-7-chloro-8-[(2e)-pent-2-en-4-yn-1-yl]-3,6,7,8-tetrahydro-2h-oxocine |
Wikidata | Q104947073 |
Mol. formula | C15H20BrClO |
CAS registry number | - |
Mol. weight | 331.6757 |
Temporary LOTUS id | LTS0271715 |
Name | (2s,4z,7s,8s)-2-[(1r)-1-bromopropyl]-7-chloro-8-[(2e)-pent-2-en-4-yn-1-yl]-3,6,7,8-tetrahydro-2h-oxocine |
Canonical SMILES | C#C/C=C/C[C@@H]1O[C@H]([C@H](Br)CC)C/C=C\C[C@@H]1Cl |
2D SMILES | C#CC=CCC1OC(C(Br)CC)CC=CCC1Cl |
IUPAC name | (2S,4Z,7S,8S)-2-[(1R)-1-bromopropyl]-7-chloro-8-[(2E)-pent-2-en-4-yn-1-yl]-3,6,7,8-tetrahydro-2H-oxocine |
InChI | InChI=1S/C15H20BrClO/c1-3-5-6-11-15-13(17)9-7-8-10-14(18-15)12(16)4-2/h1,5-8,12-15H,4,9-11H2,2H3/b6-5+,8-7-/t12-,13+,14+,15+/m1/s1 |
InChIKey | BWALZYVILRSXNY-MVHNAPEUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC=CCCC1 |
Pathway | Superclass | Class |
Fatty acids|Fatty acids | Fatty acyls|Fatty acyls | Fatty alcohols|Halogenated hydrocarbons |
Total atom number | 38 |
Heavy atom number | 18 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 5.42 |
Alogp2 | 29.41 |
Apol | 45.7679 |
Bpol | 25.4901 |
EccentricConnectivityIndexDescriptor | 268 |
FmfDescriptor | 0.4444 |
Fsp3 | 0.6 |
FragmentComplexityDescriptor | 1138.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 635 |
Xlogp | 4.436 |
ZagrebIndex | 80 |
TopoPSA | 9.23 |