Name | Methyl (1s,15e)-15-ethylidene-10,17-dimethyl-12-oxo-10,17-diazatetracyclo[12.3.1.0³,¹¹.0⁴,⁹]octadeca-3(11),4,6,8-tetraene-18-carboxylate |
Wikidata | Q104403616 |
Mol. formula | C22H26N2O3 |
CAS registry number | - |
Mol. weight | 366.4543 |
Temporary LOTUS id | LTS0271062 |
Name | Methyl (1s,15e)-15-ethylidene-10,17-dimethyl-12-oxo-10,17-diazatetracyclo[12.3.1.0³,¹¹.0⁴,⁹]octadeca-3(11),4,6,8-tetraene-18-carboxylate |
Canonical SMILES | C/C=C1/CN(C)[C@H]2Cc3c(n(C)c4ccccc34)C(=O)CC1C2C(=O)OC |
2D SMILES | CC=C1CN(C)C2Cc3c(n(C)c4ccccc34)C(=O)CC1C2C(=O)OC |
IUPAC name | methyl (1S,15E)-15-ethylidene-10,17-dimethyl-12-oxo-10,17-diazatetracyclo[12.3.1.0³,¹¹.0⁴,⁹]octadeca-3(11),4,6,8-tetraene-18-carboxylate |
InChI | InChI=1S/C22H26N2O3/c1-5-13-12-23(2)18-10-16-14-8-6-7-9-17(14)24(3)21(16)19(25)11-15(13)20(18)22(26)27-4/h5-9,15,18,20H,10-12H2,1-4H3/b13-5-/t15?,18-,20?/m0/s1 |
InChIKey | MGXLBYVOYDYHHV-VUQLXGDCSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)[nH]c3c2CC4NCCC(CC3)C4 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Corynanthe type |
Total atom number | 53 |
Heavy atom number | 27 |
Bond count | 30 |
Number of carbons | 22 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.02 |
Alogp | 3.47 |
Alogp2 | 12.07 |
Apol | 60.6626 |
Bpol | 36.2154 |
EccentricConnectivityIndexDescriptor | 466 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.4545 |
FragmentComplexityDescriptor | 2434.05 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1544 |
Xlogp | 2.374 |
ZagrebIndex | 150 |
TopoPSA | 51.54 |