Name | (3s,3ar,6r,8r,8ar,9ar)-6,8-dihydroxy-3,5,8a-trimethyl-3h,3ah,4h,6h,7h,8h,9h,9ah-naphtho[2,3-b]furan-2-one |
Wikidata | Q105128884 |
Mol. formula | C15H22O4 |
CAS registry number | - |
Mol. weight | 266.3334 |
Temporary LOTUS id | LTS0270774 |
Name | (3s,3ar,6r,8r,8ar,9ar)-6,8-dihydroxy-3,5,8a-trimethyl-3h,3ah,4h,6h,7h,8h,9h,9ah-naphtho[2,3-b]furan-2-one |
Canonical SMILES | CC1=C2C[C@@H]3[C@H](C)C(=O)O[C@@H]3C[C@@]2(C)[C@H](O)C[C@H]1O |
2D SMILES | CC1=C2CC3C(CC2(C)C(O)CC1O)OC(=O)C3C |
IUPAC name | (3S,3aR,6R,8R,8aR,9aR)-6,8-dihydroxy-3,5,8a-trimethyl-2H,3H,3aH,4H,6H,7H,8H,8aH,9H,9aH-naphtho[2,3-b]furan-2-one |
InChI | InChI=1S/C15H22O4/c1-7-9-4-10-8(2)11(16)5-13(17)15(10,3)6-12(9)19-14(7)18/h7,9,11-13,16-17H,4-6H2,1-3H3/t7-,9+,11+,12+,13+,15+/m0/s1 |
InChIKey | JIBCHCJSBYLSTP-XOGYVCSVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC3=CCCCC3CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 19 |
Bond count | 21 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.01 |
Alogp | 1.16 |
Alogp2 | 1.35 |
Apol | 44.2774 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 253 |
FmfDescriptor | 0.6842 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1507.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 602 |
Xlogp | -0.198 |
ZagrebIndex | 110 |
TopoPSA | 66.76 |