Name | 4-{2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl}-5h-furan-2-one |
Wikidata | Q105347411 |
Mol. formula | C20H30O3 |
CAS registry number | - |
Mol. weight | 318.4512 |
Temporary LOTUS id | LTS0269878 |
Name | 4-{2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl}-5h-furan-2-one |
Canonical SMILES | CC1(C)CCCC2(C)C(CCC3=CC(=O)OC3)C(CO)=CCC12 |
2D SMILES | CC1(C)CCCC2(C)C(CCC3=CC(=O)OC3)C(CO)=CCC12 |
IUPAC name | 4-{2-[2-(hydroxymethyl)-5,5,8a-trimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]ethyl}-2,5-dihydrofuran-2-one |
InChI | InChI=1S/C20H30O3/c1-19(2)9-4-10-20(3)16(15(12-21)6-8-17(19)20)7-5-14-11-18(22)23-13-14/h6,11,16-17,21H,4-5,7-10,12-13H2,1-3H3 |
InChIKey | YEUIYKUIQPYCPS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C(C1)CCC2C=CCC3CCCCC23 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Labdane diterpenoids |
Total atom number | 53 |
Heavy atom number | 23 |
Bond count | 25 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.01 |
Alogp | 4.07 |
Alogp2 | 16.58 |
Apol | 57.6098 |
Bpol | 35.6702 |
EccentricConnectivityIndexDescriptor | 398 |
FmfDescriptor | 0.7391 |
Fsp3 | 0.75 |
FragmentComplexityDescriptor | 2519.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1125 |
Xlogp | 4.831 |
ZagrebIndex | 126 |
TopoPSA | 46.53 |