Name | 2-methyl-5-(1,2,2-trimethylcyclopentyl)phenol |
Wikidata | Q82113956 |
Mol. formula | C15H22O |
CAS registry number | - |
Mol. weight | 218.3351 |
Temporary LOTUS id | LTS0268395 |
Name | 2-methyl-5-(1,2,2-trimethylcyclopentyl)phenol |
Canonical SMILES | Cc1ccc(C2(C)CCCC2(C)C)cc1O |
2D SMILES | Cc1ccc(C2(C)CCCC2(C)C)cc1O |
IUPAC name | 2-methyl-5-(1,2,2-trimethylcyclopentyl)phenol |
InChI | InChI=1S/C15H22O/c1-11-6-7-12(10-13(11)16)15(4)9-5-8-14(15,2)3/h6-7,10,16H,5,8-9H2,1-4H3 |
InChIKey | FLOTXVYOIQETTL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C2CCCC2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Cuparane sesquiterpenoids |
Total atom number | 38 |
Heavy atom number | 16 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1 |
Alogp | 4.45 |
Alogp2 | 19.78 |
Apol | 41.8714 |
Bpol | 24.0506 |
EccentricConnectivityIndexDescriptor | 188 |
FmfDescriptor | 0.6875 |
Fsp3 | 0.6 |
FragmentComplexityDescriptor | 1281.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 396 |
Xlogp | 5.571 |
ZagrebIndex | 88 |
TopoPSA | 20.23 |