Name | (2e)-3-phenylprop-2-en-1-yl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Wikidata | Q105125333 |
Mol. formula | C18H16O3 |
CAS registry number | - |
Mol. weight | 280.3185 |
Temporary LOTUS id | LTS0268371 |
Name | (2e)-3-phenylprop-2-en-1-yl (2e)-3-(4-hydroxyphenyl)prop-2-enoate |
Canonical SMILES | O=C(/C=C/c1ccc(O)cc1)OC/C=C/c1ccccc1 |
2D SMILES | O=C(C=Cc1ccc(O)cc1)OCC=Cc1ccccc1 |
IUPAC name | (2E)-3-phenylprop-2-en-1-yl (2E)-3-(4-hydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C18H16O3/c19-17-11-8-16(9-12-17)10-13-18(20)21-14-4-7-15-5-2-1-3-6-15/h1-13,19H,14H2/b7-4+,13-10+ |
InChIKey | JDBSEUVQZVQSCN-NJPWYCGFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)CC=Cc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 37 |
Heavy atom number | 21 |
Bond count | 22 |
Number of carbons | 18 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 3.94 |
Alogp2 | 15.5 |
Apol | 44.7547 |
Bpol | 20.3653 |
EccentricConnectivityIndexDescriptor | 511 |
FmfDescriptor | 0.9048 |
Fsp3 | 0.0556 |
FragmentComplexityDescriptor | 1024.03 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1226 |
Xlogp | 4.136 |
ZagrebIndex | 98 |
TopoPSA | 46.53 |