Name | (3e)-2-methyl-5-[(1r,2s,3r,4r,6s)-2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl]pent-3-en-2-ol |
Wikidata | Q105192238 |
Mol. formula | C15H24O |
CAS registry number | - |
Mol. weight | 220.351 |
Temporary LOTUS id | LTS0267418 |
Name | (3e)-2-methyl-5-[(1r,2s,3r,4r,6s)-2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl]pent-3-en-2-ol |
Canonical SMILES | CC(C)(O)/C=C/C[C@]1(C)[C@@H]2C[C@H]3[C@@H](C2)[C@]31C |
2D SMILES | CC(C)(O)C=CCC1(C)C2CC3C(C2)C31C |
IUPAC name | (3E)-2-methyl-5-[(1R,2S,3R,4r,6S)-2,3-dimethyltricyclo[2.2.1.0²,⁶]heptan-3-yl]pent-3-en-2-ol |
InChI | InChI=1S/C15H24O/c1-13(2,16)6-5-7-14(3)10-8-11-12(9-10)15(11,14)4/h5-6,10-12,16H,7-9H2,1-4H3/b6-5+/t10-,11+,12-,14-,15+/m1/s1 |
InChIKey | OHRVTGGRAFBYNX-ZGVOOZQTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1C2CC3C1C3C2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Santalane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 16 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 1.41 |
Alogp | 2.71 |
Alogp2 | 7.36 |
Apol | 43.205 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 216 |
FmfDescriptor | 0.4375 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1524.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 431 |
Xlogp | 5.041 |
ZagrebIndex | 100 |
TopoPSA | 20.23 |