Name | (+)-(7s,8s)-guaiacylglycerol |
Wikidata | Q27136117 |
Mol. formula | C10H14O5 |
CAS registry number | - |
Mol. weight | 214.2156 |
Temporary LOTUS id | LTS0266474 |
Name | (+)-(7s,8s)-guaiacylglycerol |
Canonical SMILES | COc1cc([C@H](O)[C@@H](O)CO)ccc1O |
2D SMILES | COc1cc(C(O)C(O)CO)ccc1O |
IUPAC name | (1S,2S)-1-(4-hydroxy-3-methoxyphenyl)propane-1,2,3-triol |
InChI | InChI=1S/C10H14O5/c1-15-9-4-6(2-3-7(9)12)10(14)8(13)5-11/h2-4,8,10-14H,5H2,1H3/t8-,10-/m0/s1 |
InChIKey | LSKFUSLVUZISST-WPRPVWTQSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Lignans| | Minor lignans| |
Total atom number | 29 |
Heavy atom number | 15 |
Bond count | 15 |
Number of carbons | 10 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | -0.08 |
Alogp2 | 0.01 |
Apol | 30.9451 |
Bpol | 17.2209 |
EccentricConnectivityIndexDescriptor | 181 |
FmfDescriptor | 0.4 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 631.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 372 |
Xlogp | -0.826 |
ZagrebIndex | 70 |
TopoPSA | 90.15 |