Name | (e)-tagetone |
Wikidata | Q27273267 |
Mol. formula | C10H16O |
CAS registry number | - |
Mol. weight | 152.2338 |
Temporary LOTUS id | LTS0264297 |
Name | (e)-tagetone |
Canonical SMILES | C=C/C(C)=C/C(=O)CC(C)C |
2D SMILES | C=CC(C)=CC(=O)CC(C)C |
IUPAC name | (5E)-2,6-dimethylocta-5,7-dien-4-one |
InChI | InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7+ |
InChIKey | RJXKHBTYHGBOKV-VQHVLOKHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Oxygenated hydrocarbons |
Total atom number | 27 |
Heavy atom number | 11 |
Bond count | 10 |
Number of carbons | 10 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.04 |
Alogp | 2.74 |
Alogp2 | 7.52 |
Apol | 29.0707 |
Bpol | 18.4493 |
EccentricConnectivityIndexDescriptor | 107 |
FmfDescriptor | 0 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 566.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 178 |
Xlogp | 2.89 |
ZagrebIndex | 44 |
TopoPSA | 17.07 |