Name | 6,10-bis(acetyloxy)-3-ethenyl-5-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-octahydro-1h-naphtho[2,1-b]pyran-1-yl acetate |
Wikidata | Q105143622 |
Mol. formula | C26H40O9 |
CAS registry number | - |
Mol. weight | 496.5914 |
Temporary LOTUS id | LTS0264143 |
Name | 6,10-bis(acetyloxy)-3-ethenyl-5-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-octahydro-1h-naphtho[2,1-b]pyran-1-yl acetate |
Canonical SMILES | C=CC1(C)CC(OC(C)=O)C2C(C)(O1)C(O)C(OC(C)=O)C1C(C)(CO)CCC(OC(C)=O)C12C |
2D SMILES | C=CC1(C)CC(OC(C)=O)C2C(C)(O1)C(O)C(OC(C)=O)C1C(C)(CO)CCC(OC(C)=O)C12C |
IUPAC name | 6,10-bis(acetyloxy)-3-ethenyl-5-hydroxy-7-(hydroxymethyl)-3,4a,7,10a-tetramethyl-dodecahydro-1H-naphtho[2,1-b]pyran-1-yl acetate |
InChI | InChI=1S/C26H40O9/c1-9-24(6)12-17(32-14(2)28)20-25(7)18(33-15(3)29)10-11-23(5,13-27)21(25)19(34-16(4)30)22(31)26(20,8)35-24/h9,17-22,27,31H,1,10-13H2,2-8H3 |
InChIKey | KNWFGKVPKAOCLQ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCC2C1CCC3CCCCC32 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Diterpenoids|Diterpenoids | Labdane diterpenoids|Cassane diterpenoids |
Total atom number | 75 |
Heavy atom number | 35 |
Bond count | 37 |
Number of carbons | 26 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.11 |
Alogp | 0.76 |
Alogp2 | 0.58 |
Apol | 79.6497 |
Bpol | 54.2663 |
EccentricConnectivityIndexDescriptor | 584 |
FmfDescriptor | 0.4 |
Fsp3 | 0.8077 |
FragmentComplexityDescriptor | 4739.09 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2912 |
Xlogp | 2.287 |
ZagrebIndex | 194 |
TopoPSA | 128.59 |