Name | (2r)-2-amino-3-(propane-1-sulfinyl)propanoic acid |
Wikidata | Q104253434 |
Mol. formula | C6H13NO3S |
CAS registry number | - |
Mol. weight | 179.2386 |
Temporary LOTUS id | LTS0263475 |
Name | (2r)-2-amino-3-(propane-1-sulfinyl)propanoic acid |
Canonical SMILES | CCC[S+]([O-])C[C@H](N)C(=O)O |
2D SMILES | CCC[S+]([O-])CC(N)C(=O)O |
IUPAC name | (2R)-2-amino-3-(propane-1-sulfinyl)propanoic acid |
InChI | InChI=1S/C6H13NO3S/c1-2-3-11(10)4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-,11?/m0/s1 |
InChIKey | JZKMSAGUCSIIAH-ITZCMCNPSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 24 |
Heavy atom number | 11 |
Bond count | 10 |
Number of carbons | 6 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.55 |
Alogp | -0.85 |
Alogp2 | 0.72 |
Apol | 25.6343 |
Bpol | 18.8877 |
EccentricConnectivityIndexDescriptor | 107 |
FmfDescriptor | 0 |
Fsp3 | 0.8333 |
FragmentComplexityDescriptor | 419.05 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 176 |
Xlogp | -3.592 |
ZagrebIndex | 44 |
TopoPSA | 86.38 |