Name | Methyl (4as)-1,6-dihydroxy-7-methyl-4ah,5h,6h,7h,7ah-cyclopenta[c]pyridine-4-carboxylate |
Wikidata | Q82885051 |
Mol. formula | C11H15NO4 |
CAS registry number | - |
Mol. weight | 225.2415 |
Temporary LOTUS id | LTS0263084 |
Name | Methyl (4as)-1,6-dihydroxy-7-methyl-4ah,5h,6h,7h,7ah-cyclopenta[c]pyridine-4-carboxylate |
Canonical SMILES | COC(=O)C1=CN=C(O)C2C(C)C(O)C[C@H]12 |
2D SMILES | COC(=O)C1=CN=C(O)C2C1CC(O)C2C |
IUPAC name | methyl (4aS)-1,6-dihydroxy-7-methyl-4aH,5H,6H,7H,7aH-cyclopenta[c]pyridine-4-carboxylate |
InChI | InChI=1S/C11H15NO4/c1-5-8(13)3-6-7(11(15)16-2)4-12-10(14)9(5)6/h4-6,8-9,13H,3H2,1-2H3,(H,12,14)/t5?,6-,8?,9?/m1/s1 |
InChIKey | DLTNCDMAPRTYIV-WFWLUNQWSA-N |
Deep SMILES | could not be computed |
Murcko Framework | N=1C=CC2CCCC2C1 |
Pathway | Superclass | Class |
Terpenoids | Monoterpenoids | Iridoids monoterpenoids |
Total atom number | 31 |
Heavy atom number | 16 |
Bond count | 17 |
Number of carbons | 11 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.97 |
Alogp | -0.29 |
Alogp2 | 0.08 |
Apol | 33.6699 |
Bpol | 20.5921 |
EccentricConnectivityIndexDescriptor | 184 |
FmfDescriptor | 0.5625 |
Fsp3 | 0.6364 |
FragmentComplexityDescriptor | 784.05 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 395 |
Xlogp | -0.651 |
ZagrebIndex | 84 |
TopoPSA | 79.12 |