Name | (2z)-3-[(r)-methanesulfinyl]-n-methylprop-2-enimidic acid |
Wikidata | Q105139398 |
Mol. formula | C5H9NO2S |
CAS registry number | - |
Mol. weight | 147.1967 |
Temporary LOTUS id | LTS0262355 |
Name | (2z)-3-[(r)-methanesulfinyl]-n-methylprop-2-enimidic acid |
Canonical SMILES | CN=C(O)/C=C\[S@@+](C)[O-] |
2D SMILES | CN=C(O)C=C[S+](C)[O-] |
IUPAC name | (2Z)-3-[(R)-methanesulfinyl]-N-methylprop-2-enimidic acid |
InChI | InChI=1S/C5H9NO2S/c1-6-5(7)3-4-9(2)8/h3-4H,1-2H3,(H,6,7)/b4-3-/t9-/m1/s1 |
InChIKey | KDUDZRNHMJZXLL-ZBJFTSOASA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 18 |
Heavy atom number | 9 |
Bond count | 8 |
Number of carbons | 5 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1 |
Alogp | -1.07 |
Alogp2 | 1.14 |
Apol | 20.4051 |
Bpol | 15.5369 |
EccentricConnectivityIndexDescriptor | 74 |
FmfDescriptor | 0 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 217.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 104 |
Xlogp | -0.682 |
ZagrebIndex | 34 |
TopoPSA | 55.65 |