Name | (1s,2r,5s,6s,9s)-2,6,10,10-tetramethyltricyclo[7.2.0.0²,⁵]undecan-6-ol |
Wikidata | Q104967628 |
Mol. formula | C15H26O |
CAS registry number | - |
Mol. weight | 222.3669 |
Temporary LOTUS id | LTS0258905 |
Name | (1s,2r,5s,6s,9s)-2,6,10,10-tetramethyltricyclo[7.2.0.0²,⁵]undecan-6-ol |
Canonical SMILES | CC1(C)C[C@H]2[C@@H]1CC[C@](C)(O)[C@H]1CC[C@]21C |
2D SMILES | CC1(C)CC2C1CCC(C)(O)C1CCC21C |
IUPAC name | (1S,2R,5S,6S,9S)-2,6,10,10-tetramethyltricyclo[7.2.0.0²,⁵]undecan-6-ol |
InChI | InChI=1S/C15H26O/c1-13(2)9-11-10(13)5-8-15(4,16)12-6-7-14(11,12)3/h10-12,16H,5-9H2,1-4H3/t10-,11-,12-,14+,15-/m0/s1 |
InChIKey | CPLGPDHGFNXBOA-JVSQWTDWSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CC2CCC2C3CCC3C1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Sesquiterpenoids|Sesquiterpenoids | Cycloeudesmane sesquiterpenoids|Caryophyllane sesquiterpenoids |
Total atom number | 42 |
Heavy atom number | 16 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.41 |
Alogp | 3.16 |
Alogp2 | 9.97 |
Apol | 44.5386 |
Bpol | 28.4234 |
EccentricConnectivityIndexDescriptor | 172 |
FmfDescriptor | 0.6875 |
Fsp3 | 1 |
FragmentComplexityDescriptor | 1696.01 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 365 |
Xlogp | 5.176 |
ZagrebIndex | 100 |
TopoPSA | 20.23 |