Name | 4-{3-[(3,3-dimethyloxiran-2-yl)methyl]-1h-indol-5-yl}-2-methylbut-3-en-2-ol |
Wikidata | Q105327870 |
Mol. formula | C18H23NO2 |
CAS registry number | - |
Mol. weight | 285.3814 |
Temporary LOTUS id | LTS0258578 |
Name | 4-{3-[(3,3-dimethyloxiran-2-yl)methyl]-1h-indol-5-yl}-2-methylbut-3-en-2-ol |
Canonical SMILES | CC(C)(O)C=Cc1ccc2[nH]cc(CC3OC3(C)C)c2c1 |
2D SMILES | CC(C)(O)C=Cc1ccc2[nH]cc(CC3OC3(C)C)c2c1 |
IUPAC name | 4-{3-[(3,3-dimethyloxiran-2-yl)methyl]-1H-indol-5-yl}-2-methylbut-3-en-2-ol |
InChI | InChI=1S/C18H23NO2/c1-17(2,20)8-7-12-5-6-15-14(9-12)13(11-19-15)10-16-18(3,4)21-16/h5-9,11,16,19-20H,10H2,1-4H3 |
InChIKey | XGVSTWLICQYKIZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC1Cc2c[nH]c3ccccc32 |
Pathway | Superclass | Class |
Alkaloids|Alkaloids | Tryptophan alkaloids|Tryptophan alkaloids | |Simple indole alkaloids |
Total atom number | 44 |
Heavy atom number | 21 |
Bond count | 23 |
Number of carbons | 18 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.31 |
Alogp | 3.12 |
Alogp2 | 9.76 |
Apol | 49.7202 |
Bpol | 27.7198 |
EccentricConnectivityIndexDescriptor | 387 |
FmfDescriptor | 0.619 |
Fsp3 | 0.4444 |
FragmentComplexityDescriptor | 1696.03 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 994 |
Xlogp | 3.127 |
ZagrebIndex | 118 |
TopoPSA | 48.55 |