Name | (3r,6z,10s)-3-isopropyl-6,10-dimethylcyclodec-6-ene-1,4-dione |
Wikidata | Q105139290 |
Mol. formula | C15H24O2 |
CAS registry number | - |
Mol. weight | 236.3504 |
Temporary LOTUS id | LTS0258144 |
Name | (3r,6z,10s)-3-isopropyl-6,10-dimethylcyclodec-6-ene-1,4-dione |
Canonical SMILES | C/C1=C/CC[C@H](C)C(=O)C[C@H](C(C)C)C(=O)C1 |
2D SMILES | CC1=CCCC(C)C(=O)CC(C(C)C)C(=O)C1 |
IUPAC name | (3R,6Z,10S)-6,10-dimethyl-3-(propan-2-yl)cyclodec-6-ene-1,4-dione |
InChI | InChI=1S/C15H24O2/c1-10(2)13-9-14(16)12(4)7-5-6-11(3)8-15(13)17/h6,10,12-13H,5,7-9H2,1-4H3/b11-6-/t12-,13+/m0/s1 |
InChIKey | KDPFMRXIVDLQKX-BLJGWETHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCCCCCCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 17 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.06 |
Alogp | 3.07 |
Alogp2 | 9.43 |
Apol | 44.007 |
Bpol | 28.153 |
EccentricConnectivityIndexDescriptor | 199 |
FmfDescriptor | 0.5882 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1409.02 |
PetitjeanNumber | 0.2857 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 484 |
Xlogp | 2.522 |
ZagrebIndex | 80 |
TopoPSA | 34.14 |