Name | (3r)-3-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2h-pyrano[2,3-f]chromen-4-one |
Wikidata | Q105123775 |
Mol. formula | C21H20O6 |
CAS registry number | - |
Mol. weight | 368.3807 |
Temporary LOTUS id | LTS0257210 |
Name | (3r)-3-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2h-pyrano[2,3-f]chromen-4-one |
Canonical SMILES | COc1ccc([C@@]2(O)COc3c(ccc4c3C=CC(C)(C)O4)C2=O)c(O)c1 |
2D SMILES | COc1ccc(C2(O)COc3c(ccc4c3C=CC(C)(C)O4)C2=O)c(O)c1 |
IUPAC name | (3R)-3-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-8,8-dimethyl-2H,3H,4H,8H-pyrano[2,3-f]chromen-4-one |
InChI | InChI=1S/C21H20O6/c1-20(2)9-8-13-17(27-20)7-5-14-18(13)26-11-21(24,19(14)23)15-6-4-12(25-3)10-16(15)22/h4-10,22,24H,11H2,1-3H3/t21-/m0/s1 |
InChIKey | JAIJYLCLNSGAMU-NRFANRHFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc3c(OCC(c4ccccc4)C3)c2C=CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Isoflavonoids | Isoflavanones |
Total atom number | 47 |
Heavy atom number | 27 |
Bond count | 30 |
Number of carbons | 21 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.26 |
Alogp | 2.89 |
Alogp2 | 8.33 |
Apol | 55.1079 |
Bpol | 28.5701 |
EccentricConnectivityIndexDescriptor | 610 |
FmfDescriptor | 0.7407 |
Fsp3 | 0.2857 |
FragmentComplexityDescriptor | 1798.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1776 |
Xlogp | 3.012 |
ZagrebIndex | 154 |
TopoPSA | 85.22 |