Name | 2-isopropyl-5-methyl-9-methylidenecyclodec-5-en-1-one |
Wikidata | Q105227677 |
Mol. formula | C15H24O |
CAS registry number | - |
Mol. weight | 220.351 |
Temporary LOTUS id | LTS0257046 |
Name | 2-isopropyl-5-methyl-9-methylidenecyclodec-5-en-1-one |
Canonical SMILES | C=C1CCC=C(C)CCC(C(C)C)C(=O)C1 |
2D SMILES | C=C1CCC=C(C)CCC(C(C)C)C(=O)C1 |
IUPAC name | 5-methyl-9-methylidene-2-(propan-2-yl)cyclodec-5-en-1-one |
InChI | InChI=1S/C15H24O/c1-11(2)14-9-8-12(3)6-5-7-13(4)10-15(14)16/h6,11,14H,4-5,7-10H2,1-3H3 |
InChIKey | QTFJNWQFKJITEE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCCCCCCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.03 |
Alogp | 4.23 |
Alogp2 | 17.87 |
Apol | 43.205 |
Bpol | 27.195 |
EccentricConnectivityIndexDescriptor | 182 |
FmfDescriptor | 0.625 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1360.01 |
PetitjeanNumber | 0.2857 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 420 |
Xlogp | 3.892 |
ZagrebIndex | 74 |
TopoPSA | 17.07 |