Name | (1r,3as,8as)-7-(hydroxymethyl)-1-isopropyl-3a-methyl-1,2,3,5,6,8a-hexahydroazulen-4-one |
Wikidata | Q105014221 |
Mol. formula | C15H24O2 |
CAS registry number | - |
Mol. weight | 236.3504 |
Temporary LOTUS id | LTS0253437 |
Name | (1r,3as,8as)-7-(hydroxymethyl)-1-isopropyl-3a-methyl-1,2,3,5,6,8a-hexahydroazulen-4-one |
Canonical SMILES | CC(C)[C@H]1CC[C@]2(C)C(=O)CCC(CO)=C[C@H]12 |
2D SMILES | CC(C)C1CCC2(C)C(=O)CCC(CO)=CC12 |
IUPAC name | (1R,3aS,8aS)-7-(hydroxymethyl)-3a-methyl-1-(propan-2-yl)-1,2,3,3a,4,5,6,8a-octahydroazulen-4-one |
InChI | InChI=1S/C15H24O2/c1-10(2)12-6-7-15(3)13(12)8-11(9-16)4-5-14(15)17/h8,10,12-13,16H,4-7,9H2,1-3H3/t12-,13-,15+/m1/s1 |
InChIKey | GOLVWBBRGXFBMA-NFAWXSAZSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCCC2CCC1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Sesquiterpenoids|Sesquiterpenoids | Sativane sesquiterpenoids|Cadinane sesquiterpenoids |
Total atom number | 41 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 2.72 |
Alogp2 | 7.38 |
Apol | 44.007 |
Bpol | 27.195 |
EccentricConnectivityIndexDescriptor | 196 |
FmfDescriptor | 0.5882 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1492.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 454 |
Xlogp | 2.177 |
ZagrebIndex | 90 |
TopoPSA | 37.3 |