Name | 6-methyl-2-(4-methylphenyl)hept-5-en-2-ol |
Wikidata | Q82891382 |
Mol. formula | C15H22O |
CAS registry number | - |
Mol. weight | 218.3351 |
Temporary LOTUS id | LTS0249923 |
Name | 6-methyl-2-(4-methylphenyl)hept-5-en-2-ol |
Canonical SMILES | CC(C)=CCCC(C)(O)c1ccc(C)cc1 |
2D SMILES | CC(C)=CCCC(C)(O)c1ccc(C)cc1 |
IUPAC name | 6-methyl-2-(4-methylphenyl)hept-5-en-2-ol |
InChI | InChI=1S/C15H22O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-10,16H,5,11H2,1-4H3 |
InChIKey | WQIRCLDVWQIBLO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bisabolane sesquiterpenoids |
Total atom number | 38 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 15 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.41 |
Alogp | 4.19 |
Alogp2 | 17.54 |
Apol | 41.8714 |
Bpol | 24.0506 |
EccentricConnectivityIndexDescriptor | 236 |
FmfDescriptor | 0.375 |
Fsp3 | 0.4667 |
FragmentComplexityDescriptor | 1204.01 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 484 |
Xlogp | 4 |
ZagrebIndex | 76 |
TopoPSA | 20.23 |