Name | (1s)-1-[(2s,4bs,8as)-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydro-1h-phenanthren-2-yl]ethane-1,2-diol |
Wikidata | Q105000951 |
Mol. formula | C20H34O2 |
CAS registry number | - |
Mol. weight | 306.4835 |
Temporary LOTUS id | LTS0249843 |
Name | (1s)-1-[(2s,4bs,8as)-2,4b,8,8-tetramethyl-3,4,5,6,7,8a,9,10-octahydro-1h-phenanthren-2-yl]ethane-1,2-diol |
Canonical SMILES | CC1(C)CCC[C@]2(C)C3=C(CC[C@@H]12)C[C@@](C)([C@H](O)CO)CC3 |
2D SMILES | CC1(C)CCCC2(C)C3=C(CCC12)CC(C)(C(O)CO)CC3 |
IUPAC name | (1S)-1-[(2S,4bS,8aS)-2,4b,8,8-tetramethyl-1,2,3,4,4b,5,6,7,8,8a,9,10-dodecahydrophenanthren-2-yl]ethane-1,2-diol |
InChI | InChI=1S/C20H34O2/c1-18(2)9-5-10-20(4)15-8-11-19(3,17(22)13-21)12-14(15)6-7-16(18)20/h16-17,21-22H,5-13H2,1-4H3/t16-,17+,19-,20+/m0/s1 |
InChIKey | FTAUCLDTIVGRBJ-KVPLUYHFSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C12=C(CCCC1)C3CCCCC3CC2 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Pimarane and Isopimarane diterpenoids |
Total atom number | 56 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 4.29 |
Alogp2 | 18.42 |
Apol | 59.475 |
Bpol | 37.169 |
EccentricConnectivityIndexDescriptor | 360 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 2902.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 949 |
Xlogp | 5.201 |
ZagrebIndex | 126 |
TopoPSA | 40.46 |