Name | (4e)-oct-4-en-3-one |
Wikidata | Q27236683 |
Mol. formula | C8H14O |
CAS registry number | - |
Mol. weight | 126.1965 |
Temporary LOTUS id | LTS0249349 |
Name | (4e)-oct-4-en-3-one |
Canonical SMILES | CCC/C=C/C(=O)CC |
2D SMILES | CCCC=CC(=O)CC |
IUPAC name | (4E)-oct-4-en-3-one |
InChI | InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h6-7H,3-5H2,1-2H3/b7-6+ |
InChIKey | JPTOCTSNXXKSSN-VOTSOKGWSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Oxygenated hydrocarbons |
Total atom number | 23 |
Heavy atom number | 9 |
Bond count | 8 |
Number of carbons | 8 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.05 |
Alogp | 2.44 |
Alogp2 | 5.93 |
Apol | 24.2171 |
Bpol | 16.2629 |
EccentricConnectivityIndexDescriptor | 85 |
FmfDescriptor | 0 |
Fsp3 | 0.625 |
FragmentComplexityDescriptor | 412.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 110 |
Xlogp | 2.284 |
ZagrebIndex | 32 |
TopoPSA | 17.07 |