Temporary LOTUS id | LTS0248840 |
Name | Diphysolone |
Canonical SMILES | CC(C)=CCc1c(O)cc2c(c1O)C(=O)C(c1ccc(O)cc1O)CO2 |
2D SMILES | CC(C)=CCc1c(O)cc2c(c1O)C(=O)C(c1ccc(O)cc1O)CO2 |
IUPAC name | 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-1-benzopyran-4-one |
InChI | InChI=1S/C20H20O6/c1-10(2)3-5-13-16(23)8-17-18(19(13)24)20(25)14(9-26-17)12-6-4-11(21)7-15(12)22/h3-4,6-8,14,21-24H,5,9H2,1-2H3 |
InChIKey | AMCPULFLJZMXJI-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC(c3ccccc3)C1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Isoflavonoids | Isoflavanones |
Total atom number | 46 |
Heavy atom number | 26 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.02 |
Alogp | 3.77 |
Alogp2 | 14.21 |
Apol | 53.3479 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 536 |
FmfDescriptor | 0.6154 |
Fsp3 | 0.25 |
FragmentComplexityDescriptor | 1654.06 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1628 |
Xlogp | 2.968 |
ZagrebIndex | 138 |
TopoPSA | 107.22 |