Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(1r,6r)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]chromen-4-one |
Wikidata | Q105156411 |
Mol. formula | C25H24O5 |
CAS registry number | - |
Mol. weight | 404.456 |
Temporary LOTUS id | LTS0248401 |
Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(1r,6r)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]chromen-4-one |
Canonical SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
2D SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
IUPAC name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-[(1R,6R)-3-methyl-6-(prop-1-en-2-yl)cyclohex-2-en-1-yl]-4H-chromen-4-one |
InChI | InChI=1S/C25H24O5/c1-13(2)17-9-4-14(3)10-18(17)22-20(27)11-21(28)23-24(29)19(12-30-25(22)23)15-5-7-16(26)8-6-15/h5-8,10-12,17-18,26-28H,1,4,9H2,2-3H3/t17-,18+/m0/s1 |
InChIKey | LRYZMDSDXSWBMU-ZWKOTPCHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C=C(c2ccccc2)Cc3cccc(c13)C4C=CCCC4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Isoflavonoids | Isoflavones |
Total atom number | 54 |
Heavy atom number | 30 |
Bond count | 33 |
Number of carbons | 25 |
Minimal number of rings | 4 |
Maximal number of rings | 5 |
NP-likeness score | 1 |
Alogp | 5.69 |
Alogp2 | 32.4 |
Apol | 64.013 |
Bpol | 29.111 |
EccentricConnectivityIndexDescriptor | 651 |
FmfDescriptor | 0.7333 |
Fsp3 | 0.24 |
FragmentComplexityDescriptor | 2379.05 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2291 |
Xlogp | 6.317 |
ZagrebIndex | 164 |
TopoPSA | 90.9 |