Name | 2-[(1r,4r,4as,8as)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid |
Wikidata | Q105211148 |
Mol. formula | C15H22O2 |
CAS registry number | - |
Mol. weight | 234.3345 |
Temporary LOTUS id | LTS0247705 |
Name | 2-[(1r,4r,4as,8as)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid |
Canonical SMILES | C=C(C(=O)O)[C@@H]1CC[C@@H](C)[C@@H]2CCC(C)=C[C@H]21 |
2D SMILES | C=C(C(=O)O)C1CCC(C)C2CCC(C)=CC12 |
IUPAC name | 2-[(1R,4R,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalen-1-yl]prop-2-enoic acid |
InChI | InChI=1S/C15H22O2/c1-9-4-6-12-10(2)5-7-13(14(12)8-9)11(3)15(16)17/h8,10,12-14H,3-7H2,1-2H3,(H,16,17)/t10-,12+,13+,14-/m1/s1 |
InChIKey | PLQMEXSCSAIXGB-VZZFWQQMSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCCCC2CC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Cadinane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 17 |
Bond count | 18 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.6 |
Alogp | 3.92 |
Alogp2 | 15.34 |
Apol | 42.6734 |
Bpol | 25.0086 |
EccentricConnectivityIndexDescriptor | 200 |
FmfDescriptor | 0.5882 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1328.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 476 |
Xlogp | 4.592 |
ZagrebIndex | 88 |
TopoPSA | 37.3 |