Name | 5-[(2r)-2-[2,6-dimethoxy-4-(prop-2-en-1-yl)phenoxy]propyl]-2h-1,3-benzodioxole |
Wikidata | Q105246776 |
Mol. formula | C21H24O5 |
CAS registry number | - |
Mol. weight | 356.4131 |
Temporary LOTUS id | LTS0246998 |
Name | 5-[(2r)-2-[2,6-dimethoxy-4-(prop-2-en-1-yl)phenoxy]propyl]-2h-1,3-benzodioxole |
Canonical SMILES | C=CCc1cc(OC)c(O[C@H](C)Cc2ccc3c(c2)OCO3)c(OC)c1 |
2D SMILES | C=CCc1cc(OC)c(OC(C)Cc2ccc3c(c2)OCO3)c(OC)c1 |
IUPAC name | 5-[(2R)-2-[2,6-dimethoxy-4-(prop-2-en-1-yl)phenoxy]propyl]-2H-1,3-benzodioxole |
InChI | InChI=1S/C21H24O5/c1-5-6-15-11-19(22-3)21(20(12-15)23-4)26-14(2)9-16-7-8-17-18(10-16)25-13-24-17/h5,7-8,10-12,14H,1,6,9,13H2,2-4H3/t14-/m1/s1 |
InChIKey | RWVKIBNZXPURCC-CQSZACIVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(c1ccccc1)CCc2ccc3OCOc3c2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Neolignans |
Total atom number | 50 |
Heavy atom number | 26 |
Bond count | 28 |
Number of carbons | 21 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 4.84 |
Alogp2 | 23.42 |
Apol | 56.973 |
Bpol | 35.817 |
EccentricConnectivityIndexDescriptor | 597 |
FmfDescriptor | 0.6923 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 2054.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1790 |
Xlogp | 4.877 |
ZagrebIndex | 132 |
TopoPSA | 46.15 |