Name | [4-hydroxy-1-methyl-7-(prop-1-en-2-yl)-4,5,6,7,8,8a-hexahydro-3h-naphthalen-4a-yl]methyl acetate |
Wikidata | Q104946398 |
Mol. formula | C17H26O3 |
CAS registry number | - |
Mol. weight | 278.3872 |
Temporary LOTUS id | LTS0246701 |
Name | [4-hydroxy-1-methyl-7-(prop-1-en-2-yl)-4,5,6,7,8,8a-hexahydro-3h-naphthalen-4a-yl]methyl acetate |
Canonical SMILES | C=C(C)C1CCC2(COC(C)=O)C(O)CC=C(C)C2C1 |
2D SMILES | C=C(C)C1CCC2(COC(C)=O)C(O)CC=C(C)C2C1 |
IUPAC name | [5-hydroxy-8-methyl-2-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalen-4a-yl]methyl acetate |
InChI | InChI=1S/C17H26O3/c1-11(2)14-7-8-17(10-20-13(4)18)15(9-14)12(3)5-6-16(17)19/h5,14-16,19H,1,6-10H2,2-4H3 |
InChIKey | BUYXIXTTWJYHPK-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCCCC2CC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 46 |
Heavy atom number | 20 |
Bond count | 21 |
Number of carbons | 17 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.01 |
Alogp | 2.94 |
Alogp2 | 8.64 |
Apol | 49.6626 |
Bpol | 31.2974 |
EccentricConnectivityIndexDescriptor | 278 |
FmfDescriptor | 0.5 |
Fsp3 | 0.7059 |
FragmentComplexityDescriptor | 1829.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 750 |
Xlogp | 3.246 |
ZagrebIndex | 104 |
TopoPSA | 46.53 |