Name | 6-hydroxy-10',11'-dimethoxy-5'-azaspiro[cyclohexane-1,2'-tricyclo[6.3.1.0⁴,¹²]dodecane]-1'(11'),2,8'(12'),9'-tetraen-4-one |
Wikidata | Q105146918 |
Mol. formula | C18H21NO4 |
CAS registry number | - |
Mol. weight | 315.3643 |
Temporary LOTUS id | LTS0245378 |
Name | 6-hydroxy-10',11'-dimethoxy-5'-azaspiro[cyclohexane-1,2'-tricyclo[6.3.1.0⁴,¹²]dodecane]-1'(11'),2,8'(12'),9'-tetraen-4-one |
Canonical SMILES | COc1cc2c3c(c1OC)C1(C=CC(=O)CC1O)CC3NCC2 |
2D SMILES | COc1cc2c3c(c1OC)C1(C=CC(=O)CC1O)CC3NCC2 |
IUPAC name | 6-hydroxy-10',11'-dimethoxy-5'-azaspiro[cyclohexane-1,2'-tricyclo[6.3.1.0⁴,¹²]dodecane]-1'(11'),2,8'(12'),9'-tetraen-4-one |
InChI | InChI=1S/C18H21NO4/c1-22-13-7-10-4-6-19-12-9-18(5-3-11(20)8-14(18)21)16(15(10)12)17(13)23-2/h3,5,7,12,14,19,21H,4,6,8-9H2,1-2H3 |
InChIKey | KWGMHBQBOOGVPN-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1cc2c3c(c1)C4(C=CCCC4)CC3NCC2 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Isoquinoline alkaloids |
Total atom number | 44 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 8 |
NP-likeness score | 1.02 |
Alogp | 0.87 |
Alogp2 | 0.76 |
Apol | 49.9907 |
Bpol | 28.4073 |
EccentricConnectivityIndexDescriptor | 350 |
FmfDescriptor | 0.7391 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1703.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 981 |
Xlogp | 0.513 |
ZagrebIndex | 132 |
TopoPSA | 67.79 |