Name | 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
Wikidata | Q105013484 |
Mol. formula | C9H10O4 |
CAS registry number | - |
Mol. weight | 182.1737 |
Temporary LOTUS id | LTS0244734 |
Name | 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
Canonical SMILES | CC(=O)C1(O)C=CC=CC1C(=O)O |
2D SMILES | CC(=O)C1(O)C=CC=CC1C(=O)O |
IUPAC name | 6-acetyl-6-hydroxycyclohexa-2,4-diene-1-carboxylic acid |
InChI | InChI=1S/C9H10O4/c1-6(10)9(13)5-3-2-4-7(9)8(11)12/h2-5,7,13H,1H3,(H,11,12) |
InChIKey | GNYWBJRDQHPSJL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C=1C=CCCC1 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 23 |
Heavy atom number | 13 |
Bond count | 13 |
Number of carbons | 9 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 2 |
Alogp | -0.45 |
Alogp2 | 0.2 |
Apol | 25.7159 |
Bpol | 12.8481 |
EccentricConnectivityIndexDescriptor | 105 |
FmfDescriptor | 0.4615 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 373.04 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 222 |
Xlogp | -0.274 |
ZagrebIndex | 64 |
TopoPSA | 74.6 |