Name | (2z,6e)-8-(furan-3-yl)-6-methyl-2-(4-methylpent-3-en-1-yl)octa-2,6-dienoic acid |
Wikidata | Q105128116 |
Mol. formula | C19H26O3 |
CAS registry number | - |
Mol. weight | 302.4087 |
Temporary LOTUS id | LTS0244712 |
Name | (2z,6e)-8-(furan-3-yl)-6-methyl-2-(4-methylpent-3-en-1-yl)octa-2,6-dienoic acid |
Canonical SMILES | CC(C)=CCC/C(=C/CC/C(C)=C/Cc1ccoc1)C(=O)O |
2D SMILES | CC(C)=CCCC(=CCCC(C)=CCc1ccoc1)C(=O)O |
IUPAC name | (2Z,6E)-8-(furan-3-yl)-6-methyl-2-(4-methylpent-3-en-1-yl)octa-2,6-dienoic acid |
InChI | InChI=1S/C19H26O3/c1-15(2)6-4-8-18(19(20)21)9-5-7-16(3)10-11-17-12-13-22-14-17/h6,9-10,12-14H,4-5,7-8,11H2,1-3H3,(H,20,21)/b16-10+,18-9- |
InChIKey | JHNOTXHIYSVYSU-BDVCJNJRSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1cccc1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | |Diterpenoids | | |
Total atom number | 48 |
Heavy atom number | 22 |
Bond count | 22 |
Number of carbons | 19 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.47 |
Alogp | 5.56 |
Alogp2 | 30.93 |
Apol | 53.1826 |
Bpol | 31.2974 |
EccentricConnectivityIndexDescriptor | 481 |
FmfDescriptor | 0.2273 |
Fsp3 | 0.4211 |
FragmentComplexityDescriptor | 1842.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1353 |
Xlogp | 4.521 |
ZagrebIndex | 98 |
TopoPSA | 50.44 |