Name | 4-(but-3-en-1-yl)phenol |
Wikidata | Q105036379 |
Mol. formula | C10H12O |
CAS registry number | - |
Mol. weight | 148.2021 |
Temporary LOTUS id | LTS0242675 |
Name | 4-(but-3-en-1-yl)phenol |
Canonical SMILES | C=CCCc1ccc(O)cc1 |
2D SMILES | C=CCCc1ccc(O)cc1 |
IUPAC name | 4-(but-3-en-1-yl)phenol |
InChI | InChI=1S/C10H12O/c1-2-3-4-9-5-7-10(11)8-6-9/h2,5-8,11H,1,3-4H2 |
InChIKey | IAZKGRRJAULWNS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | |Phenylpropanoids (C6-C3) | |Cinnamic acids and derivatives |
Total atom number | 23 |
Heavy atom number | 11 |
Bond count | 11 |
Number of carbons | 10 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1 |
Alogp | 3.03 |
Alogp2 | 9.16 |
Apol | 26.4035 |
Bpol | 13.1185 |
EccentricConnectivityIndexDescriptor | 129 |
FmfDescriptor | 0.5455 |
Fsp3 | 0.2 |
FragmentComplexityDescriptor | 419.01 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 174 |
Xlogp | 3.289 |
ZagrebIndex | 48 |
TopoPSA | 20.23 |