Name | 8,8-dimethyl-6h,7h-pyrano[3,2-g]chromen-2-one |
Wikidata | Q104402661 |
Mol. formula | C14H14O3 |
CAS registry number | - |
Mol. weight | 230.2597 |
Temporary LOTUS id | LTS0242500 |
Name | 8,8-dimethyl-6h,7h-pyrano[3,2-g]chromen-2-one |
Canonical SMILES | CC1(C)CCc2cc3ccc(=O)oc3cc2O1 |
2D SMILES | CC1(C)CCc2cc3ccc(=O)oc3cc2O1 |
IUPAC name | 8,8-dimethyl-2H,6H,7H,8H-pyrano[3,2-g]chromen-2-one |
InChI | InChI=1S/C14H14O3/c1-14(2)6-5-10-7-9-3-4-13(15)16-11(9)8-12(10)17-14/h3-4,7-8H,5-6H2,1-2H3 |
InChIKey | OHVLVQZSSLHFMS-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3OCCCc3cc2C=CC1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Coumarins|Coumarins | Furocoumarins|Pyranocoumarins |
Total atom number | 31 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 14 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 3.27 |
Alogp2 | 10.67 |
Apol | 36.3811 |
Bpol | 20.0949 |
EccentricConnectivityIndexDescriptor | 241 |
FmfDescriptor | 0.8235 |
Fsp3 | 0.3571 |
FragmentComplexityDescriptor | 817.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 486 |
Xlogp | 3.646 |
ZagrebIndex | 96 |
TopoPSA | 39.44 |