Name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),8,12,14(19),16-hexaene-15,18-dione |
Wikidata | Q105254972 |
Mol. formula | C18H13NO5 |
CAS registry number | - |
Mol. weight | 323.3002 |
Temporary LOTUS id | LTS0240520 |
Name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),8,12,14(19),16-hexaene-15,18-dione |
Canonical SMILES | COC1=CC(=O)c2c(cc3c4c2C2=C(CC4=CCN3)OCO2)C1=O |
2D SMILES | COC1=CC(=O)c2c(cc3c4c2C2=C(CC4=CCN3)OCO2)C1=O |
IUPAC name | 16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.0²,⁶.0⁸,²⁰.0¹⁴,¹⁹]icosa-1(20),2(6),8,12,14(19),16-hexaene-15,18-dione |
InChI | InChI=1S/C18H13NO5/c1-22-12-6-11(20)15-9(17(12)21)5-10-14-8(2-3-19-10)4-13-18(16(14)15)24-7-23-13/h2,5-6,19H,3-4,7H2,1H3 |
InChIKey | SKPNHOLSZDWKBD-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C2=C(OC1)CC3=CCNc4cc5c(c2c43)CC=CC5 |
Pathway | Superclass | Class |
Alkaloids | Tyrosine alkaloids | Aporphine alkaloids |
Total atom number | 37 |
Heavy atom number | 24 |
Bond count | 28 |
Number of carbons | 18 |
Minimal number of rings | 5 |
Maximal number of rings | 19 |
NP-likeness score | 1.04 |
Alogp | 0.53 |
Alogp2 | 0.28 |
Apol | 45.4583 |
Bpol | 22.5357 |
EccentricConnectivityIndexDescriptor | 396 |
FmfDescriptor | 0.8333 |
Fsp3 | 0.2222 |
FragmentComplexityDescriptor | 1129.06 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1100 |
Xlogp | 1.98 |
ZagrebIndex | 142 |
TopoPSA | 73.86 |