Name | 8-isopropyl-1,5-dimethylazulene |
Wikidata | Q104975044 |
Mol. formula | C15H18 |
CAS registry number | - |
Mol. weight | 198.304 |
Temporary LOTUS id | LTS0240230 |
Name | 8-isopropyl-1,5-dimethylazulene |
Canonical SMILES | Cc1ccc(C(C)C)c2c(C)ccc-2c1 |
2D SMILES | Cc1ccc(C(C)C)c2c(C)ccc-2c1 |
IUPAC name | 1,5-dimethyl-8-(propan-2-yl)azulene |
InChI | InChI=1S/C15H18/c1-10(2)14-8-5-11(3)9-13-7-6-12(4)15(13)14/h5-10H,1-4H3 |
InChIKey | DBZHHRPNWDNKNX-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc-2cccc2cc1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 33 |
Heavy atom number | 15 |
Bond count | 16 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 4.91 |
Alogp2 | 24.06 |
Apol | 38.4023 |
Bpol | 19.6777 |
EccentricConnectivityIndexDescriptor | 153 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 946 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 323 |
Xlogp | 5.552 |
ZagrebIndex | 78 |
TopoPSA | 0 |