Name | 8,12-dimethyl-4-methylidene-2-oxatricyclo[7.3.1.0⁵,¹³]tridec-11-en-3-one |
Wikidata | Q105350930 |
Mol. formula | C15H20O2 |
CAS registry number | - |
Mol. weight | 232.3187 |
Temporary LOTUS id | LTS0239249 |
Name | 8,12-dimethyl-4-methylidene-2-oxatricyclo[7.3.1.0⁵,¹³]tridec-11-en-3-one |
Canonical SMILES | C=C1C(=O)OC2C(C)=CCC3C(C)CCC1C23 |
2D SMILES | C=C1C(=O)OC2C(C)=CCC3C(C)CCC1C23 |
IUPAC name | 8,12-dimethyl-4-methylidene-2-oxatricyclo[7.3.1.0⁵,¹³]tridec-11-en-3-one |
InChI | InChI=1S/C15H20O2/c1-8-4-7-12-10(3)15(16)17-14-9(2)5-6-11(8)13(12)14/h5,8,11-14H,3-4,6-7H2,1-2H3 |
InChIKey | YNGRUBMFJCWPHB-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCC3CC=CC1C32 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Arteminisin |
Total atom number | 37 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 7 |
NP-likeness score | 0.98 |
Alogp | 3.49 |
Alogp2 | 12.19 |
Apol | 41.3399 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 199 |
FmfDescriptor | 0.7647 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 1249.02 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 434 |
Xlogp | 3.386 |
ZagrebIndex | 96 |
TopoPSA | 26.3 |