Name | 3,6,9-trimethyl-3h,3ah,4h,5h,6h,6ah,7h,8h-naphtho[4a,4-b]furan-2-one |
Wikidata | Q105263051 |
Mol. formula | C15H22O2 |
CAS registry number | - |
Mol. weight | 234.3345 |
Temporary LOTUS id | LTS0238243 |
Name | 3,6,9-trimethyl-3h,3ah,4h,5h,6h,6ah,7h,8h-naphtho[4a,4-b]furan-2-one |
Canonical SMILES | CC1=CC23OC(=O)C(C)C2CCC(C)C3CC1 |
2D SMILES | CC1=CC23OC(=O)C(C)C2CCC(C)C3CC1 |
IUPAC name | 3,6,9-trimethyl-2H,3H,3aH,4H,5H,6H,6aH,7H,8H-naphtho[4a,4-b]furan-2-one |
InChI | InChI=1S/C15H22O2/c1-9-4-6-12-10(2)5-7-13-11(3)14(16)17-15(12,13)8-9/h8,10-13H,4-7H2,1-3H3 |
InChIKey | SXDUGGRDNCRRHY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCC3CCC=CC123 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Cadinane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 17 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.12 |
Alogp | 3.57 |
Alogp2 | 12.71 |
Apol | 42.6734 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 180 |
FmfDescriptor | 0.7647 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1409.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 428 |
Xlogp | 3.17 |
ZagrebIndex | 98 |
TopoPSA | 26.3 |