Name | (1s,4r,5r,7r)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.0¹,⁵]undecane |
Wikidata | Q77574348 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0237651 |
Name | (1s,4r,5r,7r)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.0¹,⁵]undecane |
Canonical SMILES | C=C1CC[C@@H]2C[C@@H]3[C@H](C)CC[C@@]13C2(C)C |
2D SMILES | C=C1CCC2CC3C(C)CCC13C2(C)C |
IUPAC name | (1S,4R,5R,7R)-4,11,11-trimethyl-10-methylidenetricyclo[5.3.1.0¹,⁵]undecane |
InChI | InChI=1S/C15H24/c1-10-7-8-15-11(2)5-6-12(9-13(10)15)14(15,3)4/h10,12-13H,2,5-9H2,1,3-4H3/t10-,12-,13-,15-/m1/s1 |
InChIKey | SLTLKLCDQWGISZ-BPGGGUHBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CC2CC3CCCC3(C1)C2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Patchoulane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 4.18 |
Alogp2 | 17.45 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 139 |
FmfDescriptor | 0.7333 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1471 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 284 |
Xlogp | 6.448 |
ZagrebIndex | 92 |
TopoPSA | 0 |