Name | 3-ethyl-6,7-dihydroxy-3h-2-benzofuran-1-one |
Wikidata | Q103818516 |
Mol. formula | C10H10O4 |
CAS registry number | - |
Mol. weight | 194.1844 |
Temporary LOTUS id | LTS0236486 |
Name | 3-ethyl-6,7-dihydroxy-3h-2-benzofuran-1-one |
Canonical SMILES | CCC1OC(=O)c2c1ccc(O)c2O |
2D SMILES | CCC1OC(=O)c2c1ccc(O)c2O |
IUPAC name | 3-ethyl-6,7-dihydroxy-1,3-dihydro-2-benzofuran-1-one |
InChI | InChI=1S/C10H10O4/c1-2-7-5-3-4-6(11)9(12)8(5)10(13)14-7/h3-4,7,11-12H,2H2,1H3 |
InChIKey | DMJVRDSZDKSVDH-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1Cc2ccccc2C1 |
Pathway | Superclass | Class |
Polyketides | Cyclic polyketides | Phthalide derivatives |
Total atom number | 24 |
Heavy atom number | 14 |
Bond count | 15 |
Number of carbons | 10 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.01 |
Alogp | 1.81 |
Alogp2 | 3.26 |
Apol | 27.4759 |
Bpol | 13.8061 |
EccentricConnectivityIndexDescriptor | 149 |
FmfDescriptor | 0.6429 |
Fsp3 | 0.3 |
FragmentComplexityDescriptor | 443.04 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 270 |
Xlogp | 1.879 |
ZagrebIndex | 74 |
TopoPSA | 66.76 |