Name | (1r,16e)-16-ethylidene-2-methylidene-4,14-diazatetracyclo[12.2.2.0³,¹¹.0⁵,¹⁰]octadeca-3(11),5,7,9-tetraen-14-ium-14-olate |
Wikidata | Q105190260 |
Mol. formula | C19H22N2O |
CAS registry number | - |
Mol. weight | 294.3915 |
Temporary LOTUS id | LTS0236298 |
Name | (1r,16e)-16-ethylidene-2-methylidene-4,14-diazatetracyclo[12.2.2.0³,¹¹.0⁵,¹⁰]octadeca-3(11),5,7,9-tetraen-14-ium-14-olate |
Canonical SMILES | C=C1c2[nH]c3ccccc3c2CC[N+]2([O-])CC[C@@H]1/C(=C\C)C2 |
2D SMILES | C=C1c2[nH]c3ccccc3c2CC[N+]2([O-])CCC1C(=CC)C2 |
IUPAC name | (1R,16E)-16-ethylidene-2-methylidene-4,14-diazatetracyclo[12.2.2.0³,¹¹.0⁵,¹⁰]octadeca-3(11),5,7,9-tetraen-14-ium-14-olate |
InChI | InChI=1S/C19H22N2O/c1-3-14-12-21(22)10-8-15(14)13(2)19-17(9-11-21)16-6-4-5-7-18(16)20-19/h3-7,15,20H,2,8-12H2,1H3/b14-3-/t15-,21?/m0/s1 |
InChIKey | OEGNFINLTMAJKI-RYJSLZHYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)[nH]c3c2CCN4CCC(C3)CC4 |
Pathway | Superclass | Class |
- | - | - |
Total atom number | 44 |
Heavy atom number | 22 |
Bond count | 25 |
Number of carbons | 19 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.06 |
Alogp | 3.88 |
Alogp2 | 15.06 |
Apol | 51.1114 |
Bpol | 26.9886 |
EccentricConnectivityIndexDescriptor | 346 |
FmfDescriptor | 0.8182 |
Fsp3 | 0.3684 |
FragmentComplexityDescriptor | 1747.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 894 |
Xlogp | 2.55 |
ZagrebIndex | 126 |
TopoPSA | 38.85 |