Name | (3s,3as,6r,11as)-3,6,10-trimethyl-3h,3ah,4h,5h,6h,8h,11h,11ah-cyclodeca[b]furan-2,7-dione |
Wikidata | Q105213404 |
Mol. formula | C15H22O3 |
CAS registry number | - |
Mol. weight | 250.3339 |
Temporary LOTUS id | LTS0236107 |
Name | (3s,3as,6r,11as)-3,6,10-trimethyl-3h,3ah,4h,5h,6h,8h,11h,11ah-cyclodeca[b]furan-2,7-dione |
Canonical SMILES | C/C1=C\CC(=O)[C@H](C)CC[C@@H]2[C@H](C1)OC(=O)[C@H]2C |
2D SMILES | CC1=CCC(=O)C(C)CCC2C(C1)OC(=O)C2C |
IUPAC name | (3S,3aS,6R,11aS)-3,6,10-trimethyl-2H,3H,3aH,4H,5H,6H,7H,8H,11H,11aH-cyclodeca[b]furan-2,7-dione |
InChI | InChI=1S/C15H22O3/c1-9-4-7-13(16)10(2)5-6-12-11(3)15(17)18-14(12)8-9/h4,10-12,14H,5-8H2,1-3H3/b9-4+/t10-,11+,12+,14+/m1/s1 |
InChIKey | PQRMUWWEXAQGMS-MKVMKECJSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCCCCC=CCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.03 |
Alogp | 2.77 |
Alogp2 | 7.68 |
Apol | 43.4754 |
Bpol | 27.8826 |
EccentricConnectivityIndexDescriptor | 236 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1375.03 |
PetitjeanNumber | 0.375 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 558 |
Xlogp | 1.666 |
ZagrebIndex | 92 |
TopoPSA | 43.37 |