Name | (3as,5as,7s,9ar,9br)-9a-hydroxy-5a-methyl-3,9-dimethylidene-2-oxo-hexahydro-3ah-naphtho[1,2-b]furan-7-yl acetate |
Wikidata | Q105160463 |
Mol. formula | C17H22O5 |
CAS registry number | - |
Mol. weight | 306.3542 |
Temporary LOTUS id | LTS0235710 |
Name | (3as,5as,7s,9ar,9br)-9a-hydroxy-5a-methyl-3,9-dimethylidene-2-oxo-hexahydro-3ah-naphtho[1,2-b]furan-7-yl acetate |
Canonical SMILES | C=C1C(=O)O[C@@H]2[C@H]1CC[C@@]1(C)C[C@@H](OC(C)=O)CC(=C)[C@]21O |
2D SMILES | C=C1C(=O)OC2C1CCC1(C)CC(OC(C)=O)CC(=C)C21O |
IUPAC name | (3aS,5aS,7S,9aR,9bR)-9a-hydroxy-5a-methyl-3,9-dimethylidene-2-oxo-dodecahydronaphtho[1,2-b]furan-7-yl acetate |
InChI | InChI=1S/C17H22O5/c1-9-7-12(21-11(3)18)8-16(4)6-5-13-10(2)15(19)22-14(13)17(9,16)20/h12-14,20H,1-2,5-8H2,3-4H3/t12-,13-,14+,16-,17-/m0/s1 |
InChIKey | MAPRECFBTQVPIX-QZLJAVCYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC3CCCCC3C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 44 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.28 |
Alogp | 1.83 |
Alogp2 | 3.35 |
Apol | 48.5994 |
Bpol | 29.7986 |
EccentricConnectivityIndexDescriptor | 347 |
FmfDescriptor | 0.5909 |
Fsp3 | 0.6471 |
FragmentComplexityDescriptor | 1654.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 927 |
Xlogp | 0.967 |
ZagrebIndex | 126 |
TopoPSA | 72.83 |