Temporary LOTUS id | LTS0234658 |
Name | Cubebin |
Canonical SMILES | O[C@H]1OC[C@H](Cc2ccc3c(c2)OCO3)[C@H]1Cc1ccc2c(c1)OCO2 |
2D SMILES | OC1OCC(Cc2ccc3c(c2)OCO3)C1Cc1ccc2c(c1)OCO2 |
IUPAC name | (2S,3R,4R)-3,4-bis[(2H-1,3-benzodioxol-5-yl)methyl]oxolan-2-ol |
InChI | InChI=1S/C20H20O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15,20-21H,5-6,9-11H2/t14-,15+,20-/m0/s1 |
InChIKey | DIYWRNLYKJKHAM-MDOVXXIYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)CC3COCC3Cc4ccc5OCOc5c4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Dibenzylbutyrolactone lignans |
Total atom number | 46 |
Heavy atom number | 26 |
Bond count | 30 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 3.19 |
Alogp2 | 10.2 |
Apol | 53.3479 |
Bpol | 31.4441 |
EccentricConnectivityIndexDescriptor | 607 |
FmfDescriptor | 0.9615 |
Fsp3 | 0.4 |
FragmentComplexityDescriptor | 1850.06 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1760 |
Xlogp | 2.721 |
ZagrebIndex | 146 |
TopoPSA | 66.38 |