Name | 4-[(2r,4s)-2,4-dihydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-one |
Wikidata | Q104253618 |
Mol. formula | C13H20O3 |
CAS registry number | - |
Mol. weight | 224.2966 |
Temporary LOTUS id | LTS0233974 |
Name | 4-[(2r,4s)-2,4-dihydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-one |
Canonical SMILES | CC(=O)C=C=C1C(C)(C)C[C@H](O)C[C@@]1(C)O |
2D SMILES | CC(=O)C=C=C1C(C)(C)CC(O)CC1(C)O |
IUPAC name | 4-[(2R,4S)-2,4-dihydroxy-2,6,6-trimethylcyclohexylidene]but-3-en-2-one |
InChI | InChI=1S/C13H20O3/c1-9(14)5-6-11-12(2,3)7-10(15)8-13(11,4)16/h5,10,15-16H,7-8H2,1-4H3/t6?,10-,13+/m0/s1 |
InChIKey | QMXLZUOHZGYGDY-JBGXHEPSSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCCCC1 |
Pathway | Superclass | Class |
Terpenoids | Apocarotenoids | Apocarotenoids (β-) |
Total atom number | 36 |
Heavy atom number | 16 |
Bond count | 16 |
Number of carbons | 13 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.44 |
Alogp | 0.79 |
Alogp2 | 0.63 |
Apol | 38.6219 |
Bpol | 22.8221 |
EccentricConnectivityIndexDescriptor | 188 |
FmfDescriptor | 0.375 |
Fsp3 | 0.6923 |
FragmentComplexityDescriptor | 1056.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 415 |
Xlogp | 2.331 |
ZagrebIndex | 82 |
TopoPSA | 57.53 |